C26H17F3N4O — CID 155249677
5-[3-[(E)-3-oxobut-1-enyl]-4-[3-(trifluoromethyl)anilino]quinolin-6-yl]pyridine-3-carbonitrile (PubChem CID 155249677) has the molecular formula C26H17F3N4O and a molecular weight of 458.44 g/mol. Its IUPAC name is 5-[3-[(E)-3-oxobut-1-enyl]-4-[3-(trifluoromethyl)anilino]quinolin-6-yl]pyridine-3-carbonitrile.
| Compound Name | 5-[3-[(E)-3-oxobut-1-enyl]-4-[3-(trifluoromethyl)anilino]quinolin-6-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 155249677 |
| Molecular Formula | C26H17F3N4O |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 5-[3-[(E)-3-oxobut-1-enyl]-4-[3-(trifluoromethyl)anilino]quinolin-6-yl]pyridine-3-carbonitrile |
| SMILES | CC(=O)/C=C/c1cnc2ccc(-c3cncc(C#N)c3)cc2c1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H17F3N4O/c1-16(34)5-6-19-15-32-24-8-7-18(20-9-17(12-30)13-31-14-20)10-23(24)25(19)33-22-4-2-3-21(11-22)26(27,28)29/h2-11,13-15H,1H3,(H,32,33)/b6-5+ |
| InChIKey | XLYLHVQXIPZBBB-AATRIKPKSA-N |
| XLogP | 6.53 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|