C26H18ClF3N2O — CID 175186202
(E)-4-[6-chloro-2-phenyl-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one (PubChem CID 175186202) has the molecular formula C26H18ClF3N2O and a molecular weight of 466.89 g/mol. Its IUPAC name is (E)-4-[6-chloro-2-phenyl-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one.
| Compound Name | (E)-4-[6-chloro-2-phenyl-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 175186202 |
| Molecular Formula | C26H18ClF3N2O |
| Molecular Weight | 466.89 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (E)-4-[6-chloro-2-phenyl-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1c(-c2ccccc2)nc2ccc(Cl)cc2c1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H18ClF3N2O/c1-16(33)10-12-21-24(17-6-3-2-4-7-17)32-23-13-11-19(27)15-22(23)25(21)31-20-9-5-8-18(14-20)26(28,29)30/h2-15H,1H3,(H,31,32)/b12-10+ |
| InChIKey | MGZHWFBDDIXTGP-ZRDIBKRKSA-N |
| XLogP | 7.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.89 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|