C15H17NO2S — CID 143404677
N-(4-acetylphenyl)-2-[(1Z)-buta-1,3-dienyl]sulfanylpropanamide (PubChem CID 143404677) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[(1Z)-buta-1,3-dienyl]sulfanylpropanamide.
| Compound Name | N-(4-acetylphenyl)-2-[(1Z)-buta-1,3-dienyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 143404677 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N-(4-acetylphenyl)-2-[(1Z)-buta-1,3-dienyl]sulfanylpropanamide |
| SMILES | C=C/C=C\SC(C)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C15H17NO2S/c1-4-5-10-19-12(3)15(18)16-14-8-6-13(7-9-14)11(2)17/h4-10,12H,1H2,2-3H3,(H,16,18)/b10-5- |
| InChIKey | ASDDEBMTTRHUAI-YHYXMXQVSA-N |
| XLogP | 3.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|