C19H21NO2S2 — CID 42950261
N-(4-acetylphenyl)-2-[(4-methylsulfanylphenyl)methylsulfanyl]propanamide (PubChem CID 42950261) has the molecular formula C19H21NO2S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[(4-methylsulfanylphenyl)methylsulfanyl]propanamide.
| Compound Name | N-(4-acetylphenyl)-2-[(4-methylsulfanylphenyl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 42950261 |
| Molecular Formula | C19H21NO2S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N-(4-acetylphenyl)-2-[(4-methylsulfanylphenyl)methylsulfanyl]propanamide |
| SMILES | CSc1ccc(CSC(C)C(=O)Nc2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C19H21NO2S2/c1-13(21)16-6-8-17(9-7-16)20-19(22)14(2)24-12-15-4-10-18(23-3)11-5-15/h4-11,14H,12H2,1-3H3,(H,20,22) |
| InChIKey | UYDKDWBCRBDAON-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |