C14H14BrNO4 — CID 144790507
(E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyanopent-2-enoic acid (PubChem CID 144790507) has the molecular formula C14H14BrNO4 and a molecular weight of 340.17 g/mol. Its IUPAC name is (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyanopent-2-enoic acid.
| Compound Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyanopent-2-enoic acid |
|---|---|
| PubChem CID | 144790507 |
| Molecular Formula | C14H14BrNO4 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyanopent-2-enoic acid |
| SMILES | CC/C(=C(/C#N)C(=O)O)c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C14H14BrNO4/c1-4-8(10(7-16)14(17)18)9-5-12(19-2)13(20-3)6-11(9)15/h5-6H,4H2,1-3H3,(H,17,18)/b10-8+ |
| InChIKey | CTOIIOAXOXFQJD-CSKARUKUSA-N |
| XLogP | 3.24 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|