C18H15NO3 — CID 144793874
ethyl 6-(5-ethynyl-2,3-dihydro-1-benzofuran-7-yl)pyridine-2-carboxylate (PubChem CID 144793874) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is ethyl 6-(5-ethynyl-2,3-dihydro-1-benzofuran-7-yl)pyridine-2-carboxylate.
| Compound Name | ethyl 6-(5-ethynyl-2,3-dihydro-1-benzofuran-7-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 144793874 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | ethyl 6-(5-ethynyl-2,3-dihydro-1-benzofuran-7-yl)pyridine-2-carboxylate |
| SMILES | C#Cc1cc2c(c(-c3cccc(C(=O)OCC)n3)c1)OCC2 |
| InChI | InChI=1S/C18H15NO3/c1-3-12-10-13-8-9-22-17(13)14(11-12)15-6-5-7-16(19-15)18(20)21-4-2/h1,5-7,10-11H,4,8-9H2,2H3 |
| InChIKey | ZJXPNZGNAOPFHK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|