C24H25F4NO2S — CID 144794627
1-[(E)-3-[(Z)-1-[4-fluoro-2-(trifluoromethyl)phenyl]prop-1-enyl]sulfanyl-2-methylprop-2-enyl]-2,5-dimethyl-4-(2-nitroethyl)benzene (PubChem CID 144794627) has the molecular formula C24H25F4NO2S and a molecular weight of 467.53 g/mol. Its IUPAC name is 1-[(E)-3-[(Z)-1-[4-fluoro-2-(trifluoromethyl)phenyl]prop-1-enyl]sulfanyl-2-methylprop-2-enyl]-2,5-dimethyl-4-(2-nitroethyl)benzene.
| Compound Name | 1-[(E)-3-[(Z)-1-[4-fluoro-2-(trifluoromethyl)phenyl]prop-1-enyl]sulfanyl-2-methylprop-2-enyl]-2,5-dimethyl-4-(2-nitroethyl)benzene |
|---|---|
| PubChem CID | 144794627 |
| Molecular Formula | C24H25F4NO2S |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 1-[(E)-3-[(Z)-1-[4-fluoro-2-(trifluoromethyl)phenyl]prop-1-enyl]sulfanyl-2-methylprop-2-enyl]-2,5-dimethyl-4-(2-nitroethyl)benzene |
| SMILES | C/C=C(\S/C=C(\C)Cc1cc(C)c(CC[N+](=O)[O-])cc1C)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H25F4NO2S/c1-5-23(21-7-6-20(25)13-22(21)24(26,27)28)32-14-15(2)10-19-12-16(3)18(11-17(19)4)8-9-29(30)31/h5-7,11-14H,8-10H2,1-4H3/b15-14+,23-5- |
| InChIKey | UXQUYFAZPAMKCC-QLXVESJUSA-N |
| XLogP | 7.52 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|