C24H16F17NO2S — CID 176610594
[1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-nitro-1-phenylethyl]benzene (PubChem CID 176610594) has the molecular formula C24H16F17NO2S and a molecular weight of 705.43 g/mol. Its IUPAC name is [1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-nitro-1-phenylethyl]benzene.
| Compound Name | [1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-nitro-1-phenylethyl]benzene |
|---|---|
| PubChem CID | 176610594 |
| Molecular Formula | C24H16F17NO2S |
| Molecular Weight | 705.43 g/mol |
| Exact Mass | 705.06 |
| IUPAC Name | [1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-2-nitro-1-phenylethyl]benzene |
| SMILES | O=[N+]([O-])CC(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H16F17NO2S/c25-17(26,11-12-45-16(13-42(43)44,14-7-3-1-4-8-14)15-9-5-2-6-10-15)18(27,28)19(29,30)20(31,32)21(33,34)22(35,36)23(37,38)24(39,40)41/h1-10H,11-13H2 |
| InChIKey | WMIHCCTVOPTMEW-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.43 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|