About (4-hydroxyphenyl) chloromethanesulfonate
(4-hydroxyphenyl) chloromethanesulfonate (PubChem CID 14479818) has the molecular formula C7H7ClO4S
and a molecular weight of 222.65 g/mol. Its IUPAC name is (4-hydroxyphenyl) chloromethanesulfonate.
Molecular Properties
| Compound Name | (4-hydroxyphenyl) chloromethanesulfonate |
| PubChem CID | 14479818 |
| Molecular Formula | C7H7ClO4S |
| Molecular Weight | 222.65 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | (4-hydroxyphenyl) chloromethanesulfonate |
| SMILES | O=S(=O)(CCl)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C7H7ClO4S/c8-5-13(10,11)12-7-3-1-6(9)2-4-7/h1-4,9H,5H2 |
| InChIKey | SCTASVSATHHSMF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.65 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxyphenyl) chloromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyphenyl) chloromethanesulfonate?
The IUPAC name of (4-hydroxyphenyl) chloromethanesulfonate (CID 14479818) is (4-hydroxyphenyl) chloromethanesulfonate.
What is the SMILES notation for (4-hydroxyphenyl) chloromethanesulfonate?
The canonical SMILES for (4-hydroxyphenyl) chloromethanesulfonate is O=S(=O)(CCl)Oc1ccc(O)cc1.
What is the InChIKey of (4-hydroxyphenyl) chloromethanesulfonate?
The InChIKey is SCTASVSATHHSMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO4S/c8-5-13(10,11)12-7-3-1-6(9)2-4-7/h1-4,9H,5H2.
What are the key properties of (4-hydroxyphenyl) chloromethanesulfonate?
(4-hydroxyphenyl) chloromethanesulfonate has a molecular weight of 222.65 g/mol, XLogP of 1.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyphenyl) chloromethanesulfonate is sourced from PubChem (CID 14479818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).