About [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate
[4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate (PubChem CID 20688515) has the molecular formula C9H11ClO5S
and a molecular weight of 266.70 g/mol. Its IUPAC name is [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate.
Molecular Properties
| Compound Name | [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate |
| PubChem CID | 20688515 |
| Molecular Formula | C9H11ClO5S |
| Molecular Weight | 266.70 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate |
| SMILES | O=S(=O)(CCCl)Oc1ccc(COO)cc1 |
| InChI | InChI=1S/C9H11ClO5S/c10-5-6-16(12,13)15-9-3-1-8(2-4-9)7-14-11/h1-4,11H,5-7H2 |
| InChIKey | GVLZRPVVVDBQAE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.70 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate?
The IUPAC name of [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate (CID 20688515) is [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate.
What is the SMILES notation for [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate?
The canonical SMILES for [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate is O=S(=O)(CCCl)Oc1ccc(COO)cc1.
What is the InChIKey of [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate?
The InChIKey is GVLZRPVVVDBQAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO5S/c10-5-6-16(12,13)15-9-3-1-8(2-4-9)7-14-11/h1-4,11H,5-7H2.
What are the key properties of [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate?
[4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate has a molecular weight of 266.70 g/mol, XLogP of 1.62, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroperoxymethyl)phenyl] 2-chloroethanesulfonate is sourced from PubChem (CID 20688515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).