About 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole
5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole (PubChem CID 144798858) has the molecular formula C18H13Cl2FN2
and a molecular weight of 347.22 g/mol. Its IUPAC name is 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole.
Molecular Properties
| Compound Name | 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole |
| PubChem CID | 144798858 |
| Molecular Formula | C18H13Cl2FN2 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole |
| SMILES | Fc1ccc(-c2cc(/C=C/Cc3ccc(Cl)c(Cl)c3)[nH]n2)cc1 |
| InChI | InChI=1S/C18H13Cl2FN2/c19-16-9-4-12(10-17(16)20)2-1-3-15-11-18(23-22-15)13-5-7-14(21)8-6-13/h1,3-11H,2H2,(H,22,23)/b3-1+ |
| InChIKey | FQMAAYKAVBZOLU-HNQUOIGGSA-N |
| XLogP | 5.78 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole?
The IUPAC name of 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole (CID 144798858) is 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole.
What is the SMILES notation for 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole?
The canonical SMILES for 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole is Fc1ccc(-c2cc(/C=C/Cc3ccc(Cl)c(Cl)c3)[nH]n2)cc1.
What is the InChIKey of 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole?
The InChIKey is FQMAAYKAVBZOLU-HNQUOIGGSA-N. The full InChI is InChI=1S/C18H13Cl2FN2/c19-16-9-4-12(10-17(16)20)2-1-3-15-11-18(23-22-15)13-5-7-14(21)8-6-13/h1,3-11H,2H2,(H,22,23)/b3-1+.
What are the key properties of 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole?
5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole has a molecular weight of 347.22 g/mol, XLogP of 5.78, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-3-(3,4-dichlorophenyl)prop-1-enyl]-3-(4-fluorophenyl)-1H-pyrazole is sourced from PubChem (CID 144798858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).