C17H26O4 — CID 144799460
ethane;[(3E,5Z)-2-methyl-4-(prop-2-enoyloxymethyl)hepta-3,5-dienyl] prop-2-enoate (PubChem CID 144799460) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is ethane;[(3E,5Z)-2-methyl-4-(prop-2-enoyloxymethyl)hepta-3,5-dienyl] prop-2-enoate.
| Compound Name | ethane;[(3E,5Z)-2-methyl-4-(prop-2-enoyloxymethyl)hepta-3,5-dienyl] prop-2-enoate |
|---|---|
| PubChem CID | 144799460 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | ethane;[(3E,5Z)-2-methyl-4-(prop-2-enoyloxymethyl)hepta-3,5-dienyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(/C=C\C)=C/C(C)COC(=O)C=C.CC |
| InChI | InChI=1S/C15H20O4.C2H6/c1-5-8-13(11-19-15(17)7-3)9-12(4)10-18-14(16)6-2;1-2/h5-9,12H,2-3,10-11H2,1,4H3;1-2H3/b8-5-,13-9+; |
| InChIKey | GZAOWQLOMNBWED-DNPSILOFSA-N |
| XLogP | 3.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|