About [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite
[2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite (PubChem CID 144800138) has the molecular formula C6H11FO5
and a molecular weight of 182.15 g/mol. Its IUPAC name is [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite.
Analyze [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite?
The IUPAC name of [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite (CID 144800138) is [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite.
What is the SMILES notation for [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite?
The canonical SMILES for [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite is OCC1CC(O)C(O)(COF)O1.
What is the InChIKey of [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite?
The InChIKey is WUWHEPYFMUOBLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FO5/c7-11-3-6(10)5(9)1-4(2-8)12-6/h4-5,8-10H,1-3H2.
What are the key properties of [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite?
[2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite has a molecular weight of 182.15 g/mol, XLogP of -1.28, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite is sourced from PubChem (CID 144800138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).