[2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite

C6H11FO5 — CID 144800138

IUPAC[2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite
SMILESOCC1CC(O)C(O)(COF)O1
InChIInChI=1S/C6H11FO5/c7-11-3-6(10)5(9)1-4(2-8)12-6/h4-5,8-10H,1-3H2
InChIKeyWUWHEPYFMUOBLW-UHFFFAOYSA-N
MW182.15 g/mol
LogP-1.28
Rot. Bonds3

About [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite

[2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite (PubChem CID 144800138) has the molecular formula C6H11FO5 and a molecular weight of 182.15 g/mol. Its IUPAC name is [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite.

Molecular Properties

Compound Name[2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite
PubChem CID144800138
Molecular FormulaC6H11FO5
Molecular Weight182.15 g/mol
Exact Mass182.06
IUPAC Name[2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite
SMILESOCC1CC(O)C(O)(COF)O1
InChIInChI=1S/C6H11FO5/c7-11-3-6(10)5(9)1-4(2-8)12-6/h4-5,8-10H,1-3H2
InChIKeyWUWHEPYFMUOBLW-UHFFFAOYSA-N
XLogP-1.28
TPSA79.15 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.15
LogP ≤ 5-1.28
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite?
The IUPAC name of [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite (CID 144800138) is [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite.
What is the SMILES notation for [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite?
The canonical SMILES for [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite is OCC1CC(O)C(O)(COF)O1.
What is the InChIKey of [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite?
The InChIKey is WUWHEPYFMUOBLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FO5/c7-11-3-6(10)5(9)1-4(2-8)12-6/h4-5,8-10H,1-3H2.
What are the key properties of [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite?
[2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite has a molecular weight of 182.15 g/mol, XLogP of -1.28, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl hypofluorite is sourced from PubChem (CID 144800138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).