1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen

C10H16N2 — CID 144801060

IUPAC1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen
SMILESC1=CN=c2[nH]ccc2=CC1.CC.[H][H]
InChIInChI=1S/C8H8N2.C2H6.H2/c1-2-5-9-8-7(3-1)4-6-10-8;1-2;/h2-6H,1H2,(H,9,10);1-2H3;1H
InChIKeyDSUPVLUAIRTCJR-UHFFFAOYSA-N
MW164.25 g/mol
LogP1.60
Rot. Bonds

About 1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen

1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen (PubChem CID 144801060) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen.

Molecular Properties

Compound Name1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen
PubChem CID144801060
Molecular FormulaC10H16N2
Molecular Weight164.25 g/mol
Exact Mass164.13
IUPAC Name1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen
SMILESC1=CN=c2[nH]ccc2=CC1.CC.[H][H]
InChIInChI=1S/C8H8N2.C2H6.H2/c1-2-5-9-8-7(3-1)4-6-10-8;1-2;/h2-6H,1H2,(H,9,10);1-2H3;1H
InChIKeyDSUPVLUAIRTCJR-UHFFFAOYSA-N
XLogP1.60
TPSA28.15 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.25
LogP ≤ 51.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen?
The IUPAC name of 1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen (CID 144801060) is 1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen.
What is the SMILES notation for 1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen?
The canonical SMILES for 1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen is C1=CN=c2[nH]ccc2=CC1.CC.[H][H].
What is the InChIKey of 1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen?
The InChIKey is DSUPVLUAIRTCJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C2H6.H2/c1-2-5-9-8-7(3-1)4-6-10-8;1-2;/h2-6H,1H2,(H,9,10);1-2H3;1H.
What are the key properties of 1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen?
1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen has a molecular weight of 164.25 g/mol, XLogP of 1.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydropyrrolo[2,3-b]azepine;ethane;molecular hydrogen is sourced from PubChem (CID 144801060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).