C15H27NO — CID 144808679
4-methoxy-1-[(2E,4Z)-7-methylocta-2,4-dien-3-yl]piperidine (PubChem CID 144808679) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 4-methoxy-1-[(2E,4Z)-7-methylocta-2,4-dien-3-yl]piperidine.
| Compound Name | 4-methoxy-1-[(2E,4Z)-7-methylocta-2,4-dien-3-yl]piperidine |
|---|---|
| PubChem CID | 144808679 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 4-methoxy-1-[(2E,4Z)-7-methylocta-2,4-dien-3-yl]piperidine |
| SMILES | C/C=C(\C=C/CC(C)C)N1CCC(OC)CC1 |
| InChI | InChI=1S/C15H27NO/c1-5-14(8-6-7-13(2)3)16-11-9-15(17-4)10-12-16/h5-6,8,13,15H,7,9-12H2,1-4H3/b8-6-,14-5+ |
| InChIKey | KSDUTHWXBMIOAX-QIIRRSOFSA-N |
| XLogP | 3.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|