C18H30F4O — CID 144809529
3,3,4,4-tetrafluoro-6,9,10-trimethyl-5-methylidene-11-propan-2-yloxyundec-1-ene (PubChem CID 144809529) has the molecular formula C18H30F4O and a molecular weight of 338.43 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-6,9,10-trimethyl-5-methylidene-11-propan-2-yloxyundec-1-ene.
| Compound Name | 3,3,4,4-tetrafluoro-6,9,10-trimethyl-5-methylidene-11-propan-2-yloxyundec-1-ene |
|---|---|
| PubChem CID | 144809529 |
| Molecular Formula | C18H30F4O |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 3,3,4,4-tetrafluoro-6,9,10-trimethyl-5-methylidene-11-propan-2-yloxyundec-1-ene |
| SMILES | C=CC(F)(F)C(F)(F)C(=C)C(C)CCC(C)C(C)COC(C)C |
| InChI | InChI=1S/C18H30F4O/c1-8-17(19,20)18(21,22)16(7)14(5)10-9-13(4)15(6)11-23-12(2)3/h8,12-15H,1,7,9-11H2,2-6H3 |
| InChIKey | AAEMFVYDYDFPGW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|