C9H19NS — CID 144812802
6-methyl-6-propan-2-yl-1,4-thiazepane (PubChem CID 144812802) has the molecular formula C9H19NS and a molecular weight of 173.32 g/mol. Its IUPAC name is 6-methyl-6-propan-2-yl-1,4-thiazepane.
| Compound Name | 6-methyl-6-propan-2-yl-1,4-thiazepane |
|---|---|
| PubChem CID | 144812802 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 6-methyl-6-propan-2-yl-1,4-thiazepane |
| SMILES | CC(C)C1(C)CNCCSC1 |
| InChI | InChI=1S/C9H19NS/c1-8(2)9(3)6-10-4-5-11-7-9/h8,10H,4-7H2,1-3H3 |
| InChIKey | JATMWGKINXERMO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |