C6H14ClNS — CID 169438697
2,2-dimethylthiomorpholine;hydrochloride (PubChem CID 169438697) has the molecular formula C6H14ClNS and a molecular weight of 167.70 g/mol. Its IUPAC name is 2,2-dimethylthiomorpholine;hydrochloride.
| Compound Name | 2,2-dimethylthiomorpholine;hydrochloride |
|---|---|
| PubChem CID | 169438697 |
| Molecular Formula | C6H14ClNS |
| Molecular Weight | 167.70 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 2,2-dimethylthiomorpholine;hydrochloride |
| SMILES | CC1(C)CNCCS1.Cl |
| InChI | InChI=1S/C6H13NS.ClH/c1-6(2)5-7-3-4-8-6;/h7H,3-5H2,1-2H3;1H |
| InChIKey | VBDAYQSOBCWOOS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.70 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |