C8H17NS — CID 166825864
6-ethyl-6-methyl-1,4-thiazepane (PubChem CID 166825864) has the molecular formula C8H17NS and a molecular weight of 159.30 g/mol. Its IUPAC name is 6-ethyl-6-methyl-1,4-thiazepane.
| Compound Name | 6-ethyl-6-methyl-1,4-thiazepane |
|---|---|
| PubChem CID | 166825864 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | 6-ethyl-6-methyl-1,4-thiazepane |
| SMILES | CCC1(C)CNCCSC1 |
| InChI | InChI=1S/C8H17NS/c1-3-8(2)6-9-4-5-10-7-8/h9H,3-7H2,1-2H3 |
| InChIKey | QCWAPYJKFRWOCR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |