C16H26N2 — CID 144812823
5-ethyl-N,5-dimethyl-1-[(Z)-4-methylpent-1-enyl]azepin-2-imine (PubChem CID 144812823) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 5-ethyl-N,5-dimethyl-1-[(Z)-4-methylpent-1-enyl]azepin-2-imine.
| Compound Name | 5-ethyl-N,5-dimethyl-1-[(Z)-4-methylpent-1-enyl]azepin-2-imine |
|---|---|
| PubChem CID | 144812823 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 5-ethyl-N,5-dimethyl-1-[(Z)-4-methylpent-1-enyl]azepin-2-imine |
| SMILES | CCC1(C)C=C/C(=N\C)N(/C=C\CC(C)C)C=C1 |
| InChI | InChI=1S/C16H26N2/c1-6-16(4)10-9-15(17-5)18(13-11-16)12-7-8-14(2)3/h7,9-14H,6,8H2,1-5H3/b12-7-,17-15+ |
| InChIKey | NITHVCFXEKPDAY-YGVPPGCGSA-N |
| XLogP | 4.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|