C11H18O5S2 — CID 144813239
3-methylsulfonylpropyl 4-methylcyclohexa-1,5-diene-1-sulfonate (PubChem CID 144813239) has the molecular formula C11H18O5S2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 3-methylsulfonylpropyl 4-methylcyclohexa-1,5-diene-1-sulfonate.
| Compound Name | 3-methylsulfonylpropyl 4-methylcyclohexa-1,5-diene-1-sulfonate |
|---|---|
| PubChem CID | 144813239 |
| Molecular Formula | C11H18O5S2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 3-methylsulfonylpropyl 4-methylcyclohexa-1,5-diene-1-sulfonate |
| SMILES | CC1C=CC(S(=O)(=O)OCCCS(C)(=O)=O)=CC1 |
| InChI | InChI=1S/C11H18O5S2/c1-10-4-6-11(7-5-10)18(14,15)16-8-3-9-17(2,12)13/h4,6-7,10H,3,5,8-9H2,1-2H3 |
| InChIKey | PNHLNZGFBOZSLK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|