C12H20O5S2 — CID 123254925
3-methylsulfonylpropyl 4,6-dimethylcyclohexa-2,4-diene-1-sulfonate (PubChem CID 123254925) has the molecular formula C12H20O5S2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-methylsulfonylpropyl 4,6-dimethylcyclohexa-2,4-diene-1-sulfonate.
| Compound Name | 3-methylsulfonylpropyl 4,6-dimethylcyclohexa-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 123254925 |
| Molecular Formula | C12H20O5S2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-methylsulfonylpropyl 4,6-dimethylcyclohexa-2,4-diene-1-sulfonate |
| SMILES | CC1=CC(C)C(S(=O)(=O)OCCCS(C)(=O)=O)C=C1 |
| InChI | InChI=1S/C12H20O5S2/c1-10-5-6-12(11(2)9-10)19(15,16)17-7-4-8-18(3,13)14/h5-6,9,11-12H,4,7-8H2,1-3H3 |
| InChIKey | MZTDVCKVVIJAJJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|