C21H21NS — CID 144815791
2-(3,6-dimethyldibenzothiophen-4-yl)-1,2-dihydropyridine;ethene (PubChem CID 144815791) has the molecular formula C21H21NS and a molecular weight of 319.47 g/mol. Its IUPAC name is 2-(3,6-dimethyldibenzothiophen-4-yl)-1,2-dihydropyridine;ethene.
| Compound Name | 2-(3,6-dimethyldibenzothiophen-4-yl)-1,2-dihydropyridine;ethene |
|---|---|
| PubChem CID | 144815791 |
| Molecular Formula | C21H21NS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-(3,6-dimethyldibenzothiophen-4-yl)-1,2-dihydropyridine;ethene |
| SMILES | C=C.Cc1ccc2c(sc3c(C)cccc32)c1C1C=CC=CN1 |
| InChI | InChI=1S/C19H17NS.C2H4/c1-12-9-10-15-14-7-5-6-13(2)18(14)21-19(15)17(12)16-8-3-4-11-20-16;1-2/h3-11,16,20H,1-2H3;1-2H2 |
| InChIKey | WGGAWWJAIYMTMR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|