C13H17N3 — CID 144816219
2-(3,4-dihydropyridine-6-carboximidoyl)-5,5-dimethylcyclopenta-1,3-dien-1-amine (PubChem CID 144816219) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-(3,4-dihydropyridine-6-carboximidoyl)-5,5-dimethylcyclopenta-1,3-dien-1-amine.
| Compound Name | 2-(3,4-dihydropyridine-6-carboximidoyl)-5,5-dimethylcyclopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144816219 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2-(3,4-dihydropyridine-6-carboximidoyl)-5,5-dimethylcyclopenta-1,3-dien-1-amine |
| SMILES | [H]/N=C(\C1=CCCC=N1)C1=C(N)C(C)(C)C=C1 |
| InChI | InChI=1S/C13H17N3/c1-13(2)7-6-9(12(13)15)11(14)10-5-3-4-8-16-10/h5-8,14H,3-4,15H2,1-2H3/b14-11- |
| InChIKey | SJQLZQXBCWJIOK-KAMYIIQDSA-N |
| XLogP | 2.56 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|