C27H28Cl3N5S — CID 144818028
benzene;2-(2-chloropyrimidin-4-yl)sulfanyl-N-methylethanamine;2,4-dichloro-6-(2-phenylcyclobutyl)pyrimidine (PubChem CID 144818028) has the molecular formula C27H28Cl3N5S and a molecular weight of 560.98 g/mol. Its IUPAC name is benzene;2-(2-chloropyrimidin-4-yl)sulfanyl-N-methylethanamine;2,4-dichloro-6-(2-phenylcyclobutyl)pyrimidine.
| Compound Name | benzene;2-(2-chloropyrimidin-4-yl)sulfanyl-N-methylethanamine;2,4-dichloro-6-(2-phenylcyclobutyl)pyrimidine |
|---|---|
| PubChem CID | 144818028 |
| Molecular Formula | C27H28Cl3N5S |
| Molecular Weight | 560.98 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | benzene;2-(2-chloropyrimidin-4-yl)sulfanyl-N-methylethanamine;2,4-dichloro-6-(2-phenylcyclobutyl)pyrimidine |
| SMILES | CNCCSc1ccnc(Cl)n1.Clc1cc(C2CCC2c2ccccc2)nc(Cl)n1.c1ccccc1 |
| InChI | InChI=1S/C14H12Cl2N2.C7H10ClN3S.C6H6/c15-13-8-12(17-14(16)18-13)11-7-6-10(11)9-4-2-1-3-5-9;1-9-4-5-12-6-2-3-10-7(8)11-6;1-2-4-6-5-3-1/h1-5,8,10-11H,6-7H2;2-3,9H,4-5H2,1H3;1-6H |
| InChIKey | FQEGIXBUJIQUMX-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.98 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|