C29H35NO3 — CID 144818993
2-(5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-[4-(3-methoxyphenyl)phenyl]ethanone;1-methylcyclohexa-1,3-diene (PubChem CID 144818993) has the molecular formula C29H35NO3 and a molecular weight of 445.60 g/mol. Its IUPAC name is 2-(5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-[4-(3-methoxyphenyl)phenyl]ethanone;1-methylcyclohexa-1,3-diene.
| Compound Name | 2-(5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-[4-(3-methoxyphenyl)phenyl]ethanone;1-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144818993 |
| Molecular Formula | C29H35NO3 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 2-(5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-[4-(3-methoxyphenyl)phenyl]ethanone;1-methylcyclohexa-1,3-diene |
| SMILES | CC1=CC=CCC1.COc1cccc(-c2ccc(C(=O)CN3CC4CC(O)CC4C3)cc2)c1 |
| InChI | InChI=1S/C22H25NO3.C7H10/c1-26-21-4-2-3-17(11-21)15-5-7-16(8-6-15)22(25)14-23-12-18-9-20(24)10-19(18)13-23;1-7-5-3-2-4-6-7/h2-8,11,18-20,24H,9-10,12-14H2,1H3;2-3,5H,4,6H2,1H3 |
| InChIKey | KDJLYXFSARZUDC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |