C25H32BF3N2O5S — CID 144826245
(2S,4R)-4-fluoro-1-(4-fluorophenyl)sulfonyl-N-[[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-methylpyrrolidine-2-carboxamide;molecular hydrogen (PubChem CID 144826245) has the molecular formula C25H32BF3N2O5S and a molecular weight of 540.41 g/mol. Its IUPAC name is (2S,4R)-4-fluoro-1-(4-fluorophenyl)sulfonyl-N-[[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-methylpyrrolidine-2-carboxamide;molecular hydrogen.
| Compound Name | (2S,4R)-4-fluoro-1-(4-fluorophenyl)sulfonyl-N-[[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-methylpyrrolidine-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 144826245 |
| Molecular Formula | C25H32BF3N2O5S |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | (2S,4R)-4-fluoro-1-(4-fluorophenyl)sulfonyl-N-[[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-methylpyrrolidine-2-carboxamide;molecular hydrogen |
| SMILES | CC1(C)OB(c2cc(F)cc(CNC(=O)[C@@H]3C[C@@](C)(F)CN3S(=O)(=O)c3ccc(F)cc3)c2)OC1(C)C.[H][H] |
| InChI | InChI=1S/C25H30BF3N2O5S.H2/c1-23(2)24(3,4)36-26(35-23)17-10-16(11-19(28)12-17)14-30-22(32)21-13-25(5,29)15-31(21)37(33,34)20-8-6-18(27)7-9-20;/h6-12,21H,13-15H2,1-5H3,(H,30,32);1H/t21-,25+;/m0./s1 |
| InChIKey | DEMITBYEMIPMFQ-XSHMPXIGSA-N |
| XLogP | 3.32 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|