C10H19N3O — CID 144828070
5,9-dimethyl-1,5,9-triazaspiro[5.5]undecan-4-one (PubChem CID 144828070) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 5,9-dimethyl-1,5,9-triazaspiro[5.5]undecan-4-one.
| Compound Name | 5,9-dimethyl-1,5,9-triazaspiro[5.5]undecan-4-one |
|---|---|
| PubChem CID | 144828070 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 5,9-dimethyl-1,5,9-triazaspiro[5.5]undecan-4-one |
| SMILES | CN1CCC2(CC1)NCCC(=O)N2C |
| InChI | InChI=1S/C10H19N3O/c1-12-7-4-10(5-8-12)11-6-3-9(14)13(10)2/h11H,3-8H2,1-2H3 |
| InChIKey | PZLHYRNPYZQAKO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |