C7H13N4O2+ — CID 140757355
8-methyl-1-oxo-2,4,8-triaza-1-azoniaspiro[4.5]decan-3-one (PubChem CID 140757355) has the molecular formula C7H13N4O2+ and a molecular weight of 185.21 g/mol. Its IUPAC name is 8-methyl-1-oxo-2,4,8-triaza-1-azoniaspiro[4.5]decan-3-one.
| Compound Name | 8-methyl-1-oxo-2,4,8-triaza-1-azoniaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 140757355 |
| Molecular Formula | C7H13N4O2+ |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 8-methyl-1-oxo-2,4,8-triaza-1-azoniaspiro[4.5]decan-3-one |
| SMILES | CN1CCC2(CC1)NC(=O)N[N+]2=O |
| InChI | InChI=1S/C7H12N4O2/c1-10-4-2-7(3-5-10)8-6(12)9-11(7)13/h2-5H2,1H3,(H-,8,9,12,13)/p+1 |
| InChIKey | JUWUSYDDHZMTCM-UHFFFAOYSA-O |
| XLogP | -0.58 |
| TPSA | 64.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|