C11H20N4 — CID 86340576
1'-methylspiro[1,2,3,5,6,7-hexahydroimidazo[4,5-c]pyridine-4,4'-piperidine] (PubChem CID 86340576) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 1'-methylspiro[1,2,3,5,6,7-hexahydroimidazo[4,5-c]pyridine-4,4'-piperidine].
| Compound Name | 1'-methylspiro[1,2,3,5,6,7-hexahydroimidazo[4,5-c]pyridine-4,4'-piperidine] |
|---|---|
| PubChem CID | 86340576 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1'-methylspiro[1,2,3,5,6,7-hexahydroimidazo[4,5-c]pyridine-4,4'-piperidine] |
| SMILES | CN1CCC2(CC1)NCCC1=C2NCN1 |
| InChI | InChI=1S/C11H20N4/c1-15-6-3-11(4-7-15)10-9(2-5-14-11)12-8-13-10/h12-14H,2-8H2,1H3 |
| InChIKey | LFCYEKYIWOPGCN-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |