C11H21N3O — CID 135243615
8-methyl-1-propyl-1,2,8-triazaspiro[4.5]decan-3-one (PubChem CID 135243615) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 8-methyl-1-propyl-1,2,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 8-methyl-1-propyl-1,2,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 135243615 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 8-methyl-1-propyl-1,2,8-triazaspiro[4.5]decan-3-one |
| SMILES | CCCN1NC(=O)CC12CCN(C)CC2 |
| InChI | InChI=1S/C11H21N3O/c1-3-6-14-11(9-10(15)12-14)4-7-13(2)8-5-11/h3-9H2,1-2H3,(H,12,15) |
| InChIKey | GKAHCDDJJLOMAR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |