C10H12Cl2N4O2 — CID 144830209
(1E,3Z)-1-chloro-5-(5-chloro-6-methoxypyrimidin-4-yl)oxypenta-1,3-diene-1,4-diamine (PubChem CID 144830209) has the molecular formula C10H12Cl2N4O2 and a molecular weight of 291.14 g/mol. Its IUPAC name is (1E,3Z)-1-chloro-5-(5-chloro-6-methoxypyrimidin-4-yl)oxypenta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-chloro-5-(5-chloro-6-methoxypyrimidin-4-yl)oxypenta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 144830209 |
| Molecular Formula | C10H12Cl2N4O2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | (1E,3Z)-1-chloro-5-(5-chloro-6-methoxypyrimidin-4-yl)oxypenta-1,3-diene-1,4-diamine |
| SMILES | COc1ncnc(OC/C(N)=C/C=C(\N)Cl)c1Cl |
| InChI | InChI=1S/C10H12Cl2N4O2/c1-17-9-8(12)10(16-5-15-9)18-4-6(13)2-3-7(11)14/h2-3,5H,4,13-14H2,1H3/b6-2-,7-3- |
| InChIKey | LCWRKVYIJWAUDA-PORYWJCVSA-N |
| XLogP | 1.40 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|