C18H25Cl2N5O4 — CID 154946830
N-[2-[3-[[5-chloro-6-[(2Z,4E)-2,5-diamino-5-chloropenta-2,4-dienoxy]pyrimidin-4-yl]oxymethyl]cyclobutyl]oxyethyl]acetamide (PubChem CID 154946830) has the molecular formula C18H25Cl2N5O4 and a molecular weight of 446.34 g/mol. Its IUPAC name is N-[2-[3-[[5-chloro-6-[(2Z,4E)-2,5-diamino-5-chloropenta-2,4-dienoxy]pyrimidin-4-yl]oxymethyl]cyclobutyl]oxyethyl]acetamide.
| Compound Name | N-[2-[3-[[5-chloro-6-[(2Z,4E)-2,5-diamino-5-chloropenta-2,4-dienoxy]pyrimidin-4-yl]oxymethyl]cyclobutyl]oxyethyl]acetamide |
|---|---|
| PubChem CID | 154946830 |
| Molecular Formula | C18H25Cl2N5O4 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-[2-[3-[[5-chloro-6-[(2Z,4E)-2,5-diamino-5-chloropenta-2,4-dienoxy]pyrimidin-4-yl]oxymethyl]cyclobutyl]oxyethyl]acetamide |
| SMILES | CC(=O)NCCOC1CC(COc2ncnc(OC/C(N)=C/C=C(\N)Cl)c2Cl)C1 |
| InChI | InChI=1S/C18H25Cl2N5O4/c1-11(26)23-4-5-27-14-6-12(7-14)8-28-17-16(20)18(25-10-24-17)29-9-13(21)2-3-15(19)22/h2-3,10,12,14H,4-9,21-22H2,1H3,(H,23,26)/b13-2-,15-3- |
| InChIKey | BLGVSKHXBSAQJW-JHMDCKTDSA-N |
| XLogP | 1.70 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|