C13H23NO — CID 144830556
ethene;(2Z)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dien-1-amine (PubChem CID 144830556) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is ethene;(2Z)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dien-1-amine.
| Compound Name | ethene;(2Z)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 144830556 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | ethene;(2Z)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dien-1-amine |
| SMILES | C=C.C=C(C)/C=C(/CNCC)C(=C)OC |
| InChI | InChI=1S/C11H19NO.C2H4/c1-6-12-8-11(7-9(2)3)10(4)13-5;1-2/h7,12H,2,4,6,8H2,1,3,5H3;1-2H2/b11-7-; |
| InChIKey | CGIUPZQBWFGXGQ-AJULUCINSA-N |
| XLogP | 3.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|