C34H33BN4O2 — CID 144830896
N,N-diphenyl-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydrocarbazol-9-yl]pyrimidin-5-amine (PubChem CID 144830896) has the molecular formula C34H33BN4O2 and a molecular weight of 540.48 g/mol. Its IUPAC name is N,N-diphenyl-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydrocarbazol-9-yl]pyrimidin-5-amine.
| Compound Name | N,N-diphenyl-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydrocarbazol-9-yl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 144830896 |
| Molecular Formula | C34H33BN4O2 |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | N,N-diphenyl-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydrocarbazol-9-yl]pyrimidin-5-amine |
| SMILES | CC1(C)OB(C2=Cc3c(c4ccccc4n3-c3ncc(N(c4ccccc4)c4ccccc4)cn3)CC2)OC1(C)C |
| InChI | InChI=1S/C34H33BN4O2/c1-33(2)34(3,4)41-35(40-33)24-19-20-29-28-17-11-12-18-30(28)39(31(29)21-24)32-36-22-27(23-37-32)38(25-13-7-5-8-14-25)26-15-9-6-10-16-26/h5-18,21-23H,19-20H2,1-4H3 |
| InChIKey | VEQNAGCJNVRMNC-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|