C30H32BNO2 — CID 174027764
N,4-diphenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,3-dien-1-yl]aniline (PubChem CID 174027764) has the molecular formula C30H32BNO2 and a molecular weight of 449.40 g/mol. Its IUPAC name is N,4-diphenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,3-dien-1-yl]aniline.
| Compound Name | N,4-diphenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,3-dien-1-yl]aniline |
|---|---|
| PubChem CID | 174027764 |
| Molecular Formula | C30H32BNO2 |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | N,4-diphenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,3-dien-1-yl]aniline |
| SMILES | CC1(C)OB(C2=CC=C(N(c3ccccc3)c3ccc(-c4ccccc4)cc3)CC2)OC1(C)C |
| InChI | InChI=1S/C30H32BNO2/c1-29(2)30(3,4)34-31(33-29)25-17-21-28(22-18-25)32(26-13-9-6-10-14-26)27-19-15-24(16-20-27)23-11-7-5-8-12-23/h5-17,19-21H,18,22H2,1-4H3 |
| InChIKey | HMOBCOYSIXJECX-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|