C17H32N2O — CID 144831315
N-[(E)-1-methoxybut-1-enyl]-4,4-dimethyl-2-(2-methylpyrrolidin-1-yl)pent-1-en-3-amine (PubChem CID 144831315) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is N-[(E)-1-methoxybut-1-enyl]-4,4-dimethyl-2-(2-methylpyrrolidin-1-yl)pent-1-en-3-amine.
| Compound Name | N-[(E)-1-methoxybut-1-enyl]-4,4-dimethyl-2-(2-methylpyrrolidin-1-yl)pent-1-en-3-amine |
|---|---|
| PubChem CID | 144831315 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | N-[(E)-1-methoxybut-1-enyl]-4,4-dimethyl-2-(2-methylpyrrolidin-1-yl)pent-1-en-3-amine |
| SMILES | C=C(C(N/C(=C\CC)OC)C(C)(C)C)N1CCCC1C |
| InChI | InChI=1S/C17H32N2O/c1-8-10-15(20-7)18-16(17(4,5)6)14(3)19-12-9-11-13(19)2/h10,13,16,18H,3,8-9,11-12H2,1-2,4-7H3/b15-10+ |
| InChIKey | RNOLQPFWCGWGIU-XNTDXEJSSA-N |
| XLogP | 3.89 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|