C13H26OS — CID 144831329
(2S)-5,5,7,7-tetramethyl-1-sulfanylnon-8-en-2-ol (PubChem CID 144831329) has the molecular formula C13H26OS and a molecular weight of 230.42 g/mol. Its IUPAC name is (2S)-5,5,7,7-tetramethyl-1-sulfanylnon-8-en-2-ol.
| Compound Name | (2S)-5,5,7,7-tetramethyl-1-sulfanylnon-8-en-2-ol |
|---|---|
| PubChem CID | 144831329 |
| Molecular Formula | C13H26OS |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (2S)-5,5,7,7-tetramethyl-1-sulfanylnon-8-en-2-ol |
| SMILES | C=CC(C)(C)CC(C)(C)CC[C@H](O)CS |
| InChI | InChI=1S/C13H26OS/c1-6-12(2,3)10-13(4,5)8-7-11(14)9-15/h6,11,14-15H,1,7-10H2,2-5H3/t11-/m0/s1 |
| InChIKey | LRTZVJCPMJWBAH-NSHDSACASA-N |
| XLogP | 3.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|