C10H14N2 — CID 144833789
ethane;3H-pyrido[1,2-b]pyridazine (PubChem CID 144833789) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is ethane;3H-pyrido[1,2-b]pyridazine.
| Compound Name | ethane;3H-pyrido[1,2-b]pyridazine |
|---|---|
| PubChem CID | 144833789 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | ethane;3H-pyrido[1,2-b]pyridazine |
| SMILES | C1=CC2=CCC=NN2C=C1.CC |
| InChI | InChI=1S/C8H8N2.C2H6/c1-2-7-10-8(4-1)5-3-6-9-10;1-2/h1-2,4-7H,3H2;1-2H3 |
| InChIKey | RRAFTTPRFHUVOJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |