C16H20N4O2 — CID 144838869
1-[3-ethenyl-2-[(E)-2-(furan-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide (PubChem CID 144838869) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-[3-ethenyl-2-[(E)-2-(furan-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide.
| Compound Name | 1-[3-ethenyl-2-[(E)-2-(furan-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide |
|---|---|
| PubChem CID | 144838869 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-[3-ethenyl-2-[(E)-2-(furan-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide |
| SMILES | C=Cc1cccc(N(C)N)c1/C=C/c1ccco1.NNC=O |
| InChI | InChI=1S/C15H16N2O.CH4N2O/c1-3-12-6-4-8-15(17(2)16)14(12)10-9-13-7-5-11-18-13;2-3-1-4/h3-11H,1,16H2,2H3;1H,2H2,(H,3,4)/b10-9+; |
| InChIKey | KDIIZIZJBSRSCB-RRABGKBLSA-N |
| XLogP | 2.01 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|