C13H21NO3 — CID 144841821
ethane;methyl (2E,4E)-4-[(E)-hydroxyiminomethyl]-2-prop-1-en-2-ylhexa-2,4-dienoate (PubChem CID 144841821) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is ethane;methyl (2E,4E)-4-[(E)-hydroxyiminomethyl]-2-prop-1-en-2-ylhexa-2,4-dienoate.
| Compound Name | ethane;methyl (2E,4E)-4-[(E)-hydroxyiminomethyl]-2-prop-1-en-2-ylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 144841821 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | ethane;methyl (2E,4E)-4-[(E)-hydroxyiminomethyl]-2-prop-1-en-2-ylhexa-2,4-dienoate |
| SMILES | C=C(C)/C(=C\C(\C=N\O)=C/C)C(=O)OC.CC |
| InChI | InChI=1S/C11H15NO3.C2H6/c1-5-9(7-12-14)6-10(8(2)3)11(13)15-4;1-2/h5-7,14H,2H2,1,3-4H3;1-2H3/b9-5-,10-6+,12-7+; |
| InChIKey | BKJMGWKYCRWMKZ-VJJKSXPYSA-N |
| XLogP | 3.09 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|