C19H23F2N3O3 — CID 144851545
(3,4-difluorophenyl)urea;3-(4-methoxyphenyl)-4-(methylamino)butanal (PubChem CID 144851545) has the molecular formula C19H23F2N3O3 and a molecular weight of 379.41 g/mol. Its IUPAC name is (3,4-difluorophenyl)urea;3-(4-methoxyphenyl)-4-(methylamino)butanal.
| Compound Name | (3,4-difluorophenyl)urea;3-(4-methoxyphenyl)-4-(methylamino)butanal |
|---|---|
| PubChem CID | 144851545 |
| Molecular Formula | C19H23F2N3O3 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (3,4-difluorophenyl)urea;3-(4-methoxyphenyl)-4-(methylamino)butanal |
| SMILES | CNCC(CC=O)c1ccc(OC)cc1.NC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H17NO2.C7H6F2N2O/c1-13-9-11(7-8-14)10-3-5-12(15-2)6-4-10;8-5-2-1-4(3-6(5)9)11-7(10)12/h3-6,8,11,13H,7,9H2,1-2H3;1-3H,(H3,10,11,12) |
| InChIKey | WYTBZWJIJMTQMB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|