C11H14Cl2FN4O11P3 — CID 144853859
[[(2S,4R,5S)-4-chloro-5-[(6-chloropurin-9-yl)methyl]-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 144853859) has the molecular formula C11H14Cl2FN4O11P3 and a molecular weight of 561.08 g/mol. Its IUPAC name is [[(2S,4R,5S)-4-chloro-5-[(6-chloropurin-9-yl)methyl]-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,4R,5S)-4-chloro-5-[(6-chloropurin-9-yl)methyl]-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 144853859 |
| Molecular Formula | C11H14Cl2FN4O11P3 |
| Molecular Weight | 561.08 g/mol |
| Exact Mass | 559.92 |
| IUPAC Name | [[(2S,4R,5S)-4-chloro-5-[(6-chloropurin-9-yl)methyl]-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@@H]1C[C@@](F)(Cl)[C@H](Cn2cnc3c(Cl)ncnc32)O1 |
| InChI | InChI=1S/C11H14Cl2FN4O11P3/c12-9-8-10(16-4-15-9)18(5-17-8)2-7-11(13,14)1-6(27-7)3-26-31(22,23)29-32(24,25)28-30(19,20)21/h4-7H,1-3H2,(H,22,23)(H,24,25)(H2,19,20,21)/t6-,7-,11-/m0/s1 |
| InChIKey | BSUKWSGCVCFMDF-HFJPGXAFSA-N |
| XLogP | 1.89 |
| TPSA | 212.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.08 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|