C28H34N4O3S — CID 144858694
(E)-3-[4-[[2-(2,4-dihydro-1H-thieno[2,3-b]indol-8-yl)ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide;ethane;furan-2-amine (PubChem CID 144858694) has the molecular formula C28H34N4O3S and a molecular weight of 506.67 g/mol. Its IUPAC name is (E)-3-[4-[[2-(2,4-dihydro-1H-thieno[2,3-b]indol-8-yl)ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide;ethane;furan-2-amine.
| Compound Name | (E)-3-[4-[[2-(2,4-dihydro-1H-thieno[2,3-b]indol-8-yl)ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide;ethane;furan-2-amine |
|---|---|
| PubChem CID | 144858694 |
| Molecular Formula | C28H34N4O3S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (E)-3-[4-[[2-(2,4-dihydro-1H-thieno[2,3-b]indol-8-yl)ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide;ethane;furan-2-amine |
| SMILES | CC.Nc1ccco1.O=C(/C=C/c1ccc(CNCCc2cccc3[nH]c4c(c23)CCS4)cc1)NO |
| InChI | InChI=1S/C22H23N3O2S.C4H5NO.C2H6/c26-20(25-27)9-8-15-4-6-16(7-5-15)14-23-12-10-17-2-1-3-19-21(17)18-11-13-28-22(18)24-19;5-4-2-1-3-6-4;1-2/h1-9,23-24,27H,10-14H2,(H,25,26);1-3H,5H2;1-2H3/b9-8+;; |
| InChIKey | MFNVQFDWVILYFL-YEUQMBKVSA-N |
| XLogP | 5.55 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|