C28H34N4O2 — CID 144858774
(E)-N-hydroxy-3-[4-[[2-(1,2,3,4-tetrahydrocyclopenta[b]indol-8-yl)ethylamino]methyl]phenyl]prop-2-enamide;4-methyl-2,3-dihydro-1H-pyrrole (PubChem CID 144858774) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-[[2-(1,2,3,4-tetrahydrocyclopenta[b]indol-8-yl)ethylamino]methyl]phenyl]prop-2-enamide;4-methyl-2,3-dihydro-1H-pyrrole.
| Compound Name | (E)-N-hydroxy-3-[4-[[2-(1,2,3,4-tetrahydrocyclopenta[b]indol-8-yl)ethylamino]methyl]phenyl]prop-2-enamide;4-methyl-2,3-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 144858774 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | (E)-N-hydroxy-3-[4-[[2-(1,2,3,4-tetrahydrocyclopenta[b]indol-8-yl)ethylamino]methyl]phenyl]prop-2-enamide;4-methyl-2,3-dihydro-1H-pyrrole |
| SMILES | CC1=CNCC1.O=C(/C=C/c1ccc(CNCCc2cccc3[nH]c4c(c23)CCC4)cc1)NO |
| InChI | InChI=1S/C23H25N3O2.C5H9N/c27-22(26-28)12-11-16-7-9-17(10-8-16)15-24-14-13-18-3-1-6-21-23(18)19-4-2-5-20(19)25-21;1-5-2-3-6-4-5/h1,3,6-12,24-25,28H,2,4-5,13-15H2,(H,26,27);4,6H,2-3H2,1H3/b12-11+; |
| InChIKey | YIWYUUOJMBJKEG-CALJPSDSSA-N |
| XLogP | 4.39 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|