C7H9N — CID 144858732
(3Z)-3-ethylidene-2-methylidene-1H-pyrrole (PubChem CID 144858732) has the molecular formula C7H9N and a molecular weight of 107.16 g/mol. Its IUPAC name is (3Z)-3-ethylidene-2-methylidene-1H-pyrrole.
| Compound Name | (3Z)-3-ethylidene-2-methylidene-1H-pyrrole |
|---|---|
| PubChem CID | 144858732 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | (3Z)-3-ethylidene-2-methylidene-1H-pyrrole |
| SMILES | C=c1[nH]cc/c1=C/C |
| InChI | InChI=1S/C7H9N/c1-3-7-4-5-8-6(7)2/h3-5,8H,2H2,1H3/b7-3- |
| InChIKey | XBVWMODHEUBACR-CLTKARDFSA-N |
| XLogP | 0.23 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |