C29H34F2N4O — CID 144862488
2-[2-[6-(difluoromethyl)-3-pyridinyl]ethyl]-5-ethyl-N-methylaniline;4-[5-(ethylideneamino)-6-methyl-3-pyridinyl]but-3-yn-1-ol (PubChem CID 144862488) has the molecular formula C29H34F2N4O and a molecular weight of 492.61 g/mol. Its IUPAC name is 2-[2-[6-(difluoromethyl)-3-pyridinyl]ethyl]-5-ethyl-N-methylaniline;4-[5-(ethylideneamino)-6-methyl-3-pyridinyl]but-3-yn-1-ol.
| Compound Name | 2-[2-[6-(difluoromethyl)-3-pyridinyl]ethyl]-5-ethyl-N-methylaniline;4-[5-(ethylideneamino)-6-methyl-3-pyridinyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 144862488 |
| Molecular Formula | C29H34F2N4O |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 2-[2-[6-(difluoromethyl)-3-pyridinyl]ethyl]-5-ethyl-N-methylaniline;4-[5-(ethylideneamino)-6-methyl-3-pyridinyl]but-3-yn-1-ol |
| SMILES | C/C=N/c1cc(C#CCCO)cnc1C.CCc1ccc(CCc2ccc(C(F)F)nc2)c(NC)c1 |
| InChI | InChI=1S/C17H20F2N2.C12H14N2O/c1-3-12-4-7-14(16(10-12)20-2)8-5-13-6-9-15(17(18)19)21-11-13;1-3-13-12-8-11(6-4-5-7-15)9-14-10(12)2/h4,6-7,9-11,17,20H,3,5,8H2,1-2H3;3,8-9,15H,5,7H2,1-2H3/b;13-3+ |
| InChIKey | YDVXTJJNSSHIJE-HTMHAVNMSA-N |
| XLogP | 6.25 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|