About formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide
formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide (PubChem CID 144862660) has the molecular formula C24H19N3O2
and a molecular weight of 381.44 g/mol. Its IUPAC name is formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide.
Molecular Properties
| Compound Name | formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide |
| PubChem CID | 144862660 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide |
| SMILES | C#N.Cc1ccc(-c2cc(-c3ccc(C(N)=O)cc3)cc(-c3ccco3)n2)cc1 |
| InChI | InChI=1S/C23H18N2O2.CHN/c1-15-4-6-17(7-5-15)20-13-19(14-21(25-20)22-3-2-12-27-22)16-8-10-18(11-9-16)23(24)26;1-2/h2-14H,1H3,(H2,24,26);1H |
| InChIKey | PLOWWYCQZRKKOY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide?
The IUPAC name of formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide (CID 144862660) is formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide.
What is the SMILES notation for formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide?
The canonical SMILES for formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide is C#N.Cc1ccc(-c2cc(-c3ccc(C(N)=O)cc3)cc(-c3ccco3)n2)cc1.
What is the InChIKey of formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide?
The InChIKey is PLOWWYCQZRKKOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O2.CHN/c1-15-4-6-17(7-5-15)20-13-19(14-21(25-20)22-3-2-12-27-22)16-8-10-18(11-9-16)23(24)26;1-2/h2-14H,1H3,(H2,24,26);1H.
What are the key properties of formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide?
formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide has a molecular weight of 381.44 g/mol, XLogP of 5.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;4-[2-(furan-2-yl)-6-(4-methylphenyl)-4-pyridinyl]benzamide is sourced from PubChem (CID 144862660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).