C18H20ClIN4O2S — CID 144863370
tert-butyl N-[7-(2-chloropyrimidin-4-yl)-1-iodosulfanyl-3,4-dihydro-2H-quinolin-4-yl]carbamate (PubChem CID 144863370) has the molecular formula C18H20ClIN4O2S and a molecular weight of 518.81 g/mol. Its IUPAC name is tert-butyl N-[7-(2-chloropyrimidin-4-yl)-1-iodosulfanyl-3,4-dihydro-2H-quinolin-4-yl]carbamate.
| Compound Name | tert-butyl N-[7-(2-chloropyrimidin-4-yl)-1-iodosulfanyl-3,4-dihydro-2H-quinolin-4-yl]carbamate |
|---|---|
| PubChem CID | 144863370 |
| Molecular Formula | C18H20ClIN4O2S |
| Molecular Weight | 518.81 g/mol |
| Exact Mass | 518.00 |
| IUPAC Name | tert-butyl N-[7-(2-chloropyrimidin-4-yl)-1-iodosulfanyl-3,4-dihydro-2H-quinolin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(SI)c2cc(-c3ccnc(Cl)n3)ccc21 |
| InChI | InChI=1S/C18H20ClIN4O2S/c1-18(2,3)26-17(25)23-14-7-9-24(27-20)15-10-11(4-5-12(14)15)13-6-8-21-16(19)22-13/h4-6,8,10,14H,7,9H2,1-3H3,(H,23,25) |
| InChIKey | BWMFOVUSUQVKFN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.81 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|