C20H38F2 — CID 144864514
(E)-7,8-difluoro-2,5,6,9,10,13-hexamethyltetradec-4-ene (PubChem CID 144864514) has the molecular formula C20H38F2 and a molecular weight of 316.52 g/mol. Its IUPAC name is (E)-7,8-difluoro-2,5,6,9,10,13-hexamethyltetradec-4-ene.
| Compound Name | (E)-7,8-difluoro-2,5,6,9,10,13-hexamethyltetradec-4-ene |
|---|---|
| PubChem CID | 144864514 |
| Molecular Formula | C20H38F2 |
| Molecular Weight | 316.52 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | (E)-7,8-difluoro-2,5,6,9,10,13-hexamethyltetradec-4-ene |
| SMILES | C/C(=C\CC(C)C)C(C)C(F)C(F)C(C)C(C)CCC(C)C |
| InChI | InChI=1S/C20H38F2/c1-13(2)9-11-15(5)17(7)19(21)20(22)18(8)16(6)12-10-14(3)4/h11,13-14,16-20H,9-10,12H2,1-8H3/b15-11+ |
| InChIKey | YDNYBWVXSUHIMG-RVDMUPIBSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.52 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|